C26H27N3O3S3 — CID 4191867
ethyl 2-[[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 4191867) has the molecular formula C26H27N3O3S3 and a molecular weight of 525.72 g/mol. Its IUPAC name is ethyl 2-[[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 4191867 |
| Molecular Formula | C26H27N3O3S3 |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | ethyl 2-[[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(-c3nc4ccccc4s3)s2)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C26H27N3O3S3/c1-6-32-24(31)19-14-13-25(2,3)29-26(4,5)20(14)35-23(19)28-21(30)17-11-12-18(33-17)22-27-15-9-7-8-10-16(15)34-22/h7-12,29H,6,13H2,1-5H3,(H,28,30) |
| InChIKey | LQNYZHLSEQDAMO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |