C23H30N2O5S2 — CID 41028465
ethyl 2-[(2-ethylsulfonylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 41028465) has the molecular formula C23H30N2O5S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is ethyl 2-[(2-ethylsulfonylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(2-ethylsulfonylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 41028465 |
| Molecular Formula | C23H30N2O5S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | ethyl 2-[(2-ethylsulfonylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccccc2S(=O)(=O)CC)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C23H30N2O5S2/c1-7-30-21(27)17-15-13-22(3,4)25-23(5,6)18(15)31-20(17)24-19(26)14-11-9-10-12-16(14)32(28,29)8-2/h9-12,25H,7-8,13H2,1-6H3,(H,24,26) |
| InChIKey | INRJTIVXPSRVNF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |