C22H25N3O3S — CID 9290540
[2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] 3-methylbenzoate (PubChem CID 9290540) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] 3-methylbenzoate.
| Compound Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 9290540 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)Nc2sc3c(c2C#N)CC(C)(C)NC3(C)C)c1 |
| InChI | InChI=1S/C22H25N3O3S/c1-13-7-6-8-14(9-13)20(27)28-12-17(26)24-19-16(11-23)15-10-21(2,3)25-22(4,5)18(15)29-19/h6-9,25H,10,12H2,1-5H3,(H,24,26) |
| InChIKey | RZFYTILAQXRKQU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |