C23H30N4O2S — CID 8789004
N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-2-[(3-methoxyphenyl)methyl-methylamino]acetamide (PubChem CID 8789004) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-2-[(3-methoxyphenyl)methyl-methylamino]acetamide.
| Compound Name | N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-2-[(3-methoxyphenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 8789004 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-2-[(3-methoxyphenyl)methyl-methylamino]acetamide |
| SMILES | COc1cccc(CN(C)CC(=O)Nc2sc3c(c2C#N)CC(C)(C)NC3(C)C)c1 |
| InChI | InChI=1S/C23H30N4O2S/c1-22(2)11-17-18(12-24)21(30-20(17)23(3,4)26-22)25-19(28)14-27(5)13-15-8-7-9-16(10-15)29-6/h7-10,26H,11,13-14H2,1-6H3,(H,25,28) |
| InChIKey | ZYCBAFPHJIEJKH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |