C24H32N4OS — CID 9132946
N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-2-[[(1S)-2-methyl-1-phenylpropyl]amino]acetamide (PubChem CID 9132946) has the molecular formula C24H32N4OS and a molecular weight of 424.61 g/mol. Its IUPAC name is N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-2-[[(1S)-2-methyl-1-phenylpropyl]amino]acetamide.
| Compound Name | N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-2-[[(1S)-2-methyl-1-phenylpropyl]amino]acetamide |
|---|---|
| PubChem CID | 9132946 |
| Molecular Formula | C24H32N4OS |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-2-[[(1S)-2-methyl-1-phenylpropyl]amino]acetamide |
| SMILES | CC(C)[C@H](NCC(=O)Nc1sc2c(c1C#N)CC(C)(C)NC2(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H32N4OS/c1-15(2)20(16-10-8-7-9-11-16)26-14-19(29)27-22-18(13-25)17-12-23(3,4)28-24(5,6)21(17)30-22/h7-11,15,20,26,28H,12,14H2,1-6H3,(H,27,29)/t20-/m0/s1 |
| InChIKey | HEHRUXXIUWMEMQ-FQEVSTJZSA-N |
| XLogP | 4.70 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |