C19H21N3O3S2 — CID 8645567
[2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] thiophene-3-carboxylate (PubChem CID 8645567) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] thiophene-3-carboxylate.
| Compound Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] thiophene-3-carboxylate |
|---|---|
| PubChem CID | 8645567 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] thiophene-3-carboxylate |
| SMILES | CC1(C)Cc2c(sc(NC(=O)COC(=O)c3ccsc3)c2C#N)C(C)(C)N1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-18(2)7-12-13(8-20)16(27-15(12)19(3,4)22-18)21-14(23)9-25-17(24)11-5-6-26-10-11/h5-6,10,22H,7,9H2,1-4H3,(H,21,23) |
| InChIKey | KCELHHWFHPSKCM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |