C23H27N3O3S — CID 9016249
[2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] 3-phenylpropanoate (PubChem CID 9016249) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] 3-phenylpropanoate.
| Compound Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 9016249 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)amino]-2-oxoethyl] 3-phenylpropanoate |
| SMILES | CC1(C)Cc2c(sc(NC(=O)COC(=O)CCc3ccccc3)c2C#N)C(C)(C)N1 |
| InChI | InChI=1S/C23H27N3O3S/c1-22(2)12-16-17(13-24)21(30-20(16)23(3,4)26-22)25-18(27)14-29-19(28)11-10-15-8-6-5-7-9-15/h5-9,26H,10-12,14H2,1-4H3,(H,25,27) |
| InChIKey | QRPLQJLNJZYFEH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |