C27H29N3OS2 — CID 3353864
N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-phenylpropanamide (PubChem CID 3353864) has the molecular formula C27H29N3OS2 and a molecular weight of 475.68 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-phenylpropanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 3353864 |
| Molecular Formula | C27H29N3OS2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-phenylpropanamide |
| SMILES | CC1(C)Cc2c(sc(NC(=O)CCc3ccccc3)c2-c2nc3ccccc3s2)C(C)(C)N1 |
| InChI | InChI=1S/C27H29N3OS2/c1-26(2)16-18-22(24-28-19-12-8-9-13-20(19)32-24)25(33-23(18)27(3,4)30-26)29-21(31)15-14-17-10-6-5-7-11-17/h5-13,30H,14-16H2,1-4H3,(H,29,31) |
| InChIKey | PUSCWWRDTSPLEN-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |