C27H29N3O2S2 — CID 4547145
N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-phenoxypropanamide (PubChem CID 4547145) has the molecular formula C27H29N3O2S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-phenoxypropanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 4547145 |
| Molecular Formula | C27H29N3O2S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-phenoxypropanamide |
| SMILES | CC1(C)Cc2c(sc(NC(=O)CCOc3ccccc3)c2-c2nc3ccccc3s2)C(C)(C)N1 |
| InChI | InChI=1S/C27H29N3O2S2/c1-26(2)16-18-22(24-28-19-12-8-9-13-20(19)33-24)25(34-23(18)27(3,4)30-26)29-21(31)14-15-32-17-10-6-5-7-11-17/h5-13,30H,14-16H2,1-4H3,(H,29,31) |
| InChIKey | UVACSYNQFYLJOW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |