C29H28N4O3S2 — CID 3605288
N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 3605288) has the molecular formula C29H28N4O3S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 3605288 |
| Molecular Formula | C29H28N4O3S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | CC1(C)Cc2c(sc(NC(=O)c3cccc(N4C(=O)CCC4=O)c3)c2-c2nc3ccccc3s2)C(C)(C)N1 |
| InChI | InChI=1S/C29H28N4O3S2/c1-28(2)15-18-23(26-30-19-10-5-6-11-20(19)37-26)27(38-24(18)29(3,4)32-28)31-25(36)16-8-7-9-17(14-16)33-21(34)12-13-22(33)35/h5-11,14,32H,12-13,15H2,1-4H3,(H,31,36) |
| InChIKey | JVRKNJZBZHLSDH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|