C22H17N5O3S — CID 27378367
N-[2-(1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 27378367) has the molecular formula C22H17N5O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 27378367 |
| Molecular Formula | C22H17N5O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)-5-methylpyrazol-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(N3C(=O)CCC3=O)c2)n(-c2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C22H17N5O3S/c1-13-11-18(27(25-13)22-23-16-7-2-3-8-17(16)31-22)24-21(30)14-5-4-6-15(12-14)26-19(28)9-10-20(26)29/h2-8,11-12H,9-10H2,1H3,(H,24,30) |
| InChIKey | PGZJNFCGCCQYRY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|