C25H25N3OS3 — CID 6089260
(E)-N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 6089260) has the molecular formula C25H25N3OS3 and a molecular weight of 479.70 g/mol. Its IUPAC name is (E)-N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6089260 |
| Molecular Formula | C25H25N3OS3 |
| Molecular Weight | 479.70 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (E)-N-[3-(1,3-benzothiazol-2-yl)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CC1(C)Cc2c(sc(NC(=O)/C=C/c3cccs3)c2-c2nc3ccccc3s2)C(C)(C)N1 |
| InChI | InChI=1S/C25H25N3OS3/c1-24(2)14-16-20(22-26-17-9-5-6-10-18(17)31-22)23(32-21(16)25(3,4)28-24)27-19(29)12-11-15-8-7-13-30-15/h5-13,28H,14H2,1-4H3,(H,27,29)/b12-11+ |
| InChIKey | FVKLFGZVPSVLHN-VAWYXSNFSA-N |
| XLogP | 6.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.70 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|