C29H31N3O4S2 — CID 43950591
(E)-N-[3-(1,3-benzothiazol-2-yl)-6-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 43950591) has the molecular formula C29H31N3O4S2 and a molecular weight of 549.72 g/mol. Its IUPAC name is (E)-N-[3-(1,3-benzothiazol-2-yl)-6-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-(1,3-benzothiazol-2-yl)-6-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43950591 |
| Molecular Formula | C29H31N3O4S2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | (E)-N-[3-(1,3-benzothiazol-2-yl)-6-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2sc3c(c2-c2nc4ccccc4s2)CCN(C(C)C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C29H31N3O4S2/c1-17(2)32-13-12-19-24(16-32)38-29(26(19)28-30-20-8-6-7-9-23(20)37-28)31-25(33)11-10-18-14-21(34-3)27(36-5)22(15-18)35-4/h6-11,14-15,17H,12-13,16H2,1-5H3,(H,31,33)/b11-10+ |
| InChIKey | LVCRMDSLWKKKGW-ZHACJKMWSA-N |
| XLogP | 6.47 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|