C27H28ClN3O4S2 — CID 121023583
(E)-N-[3-(1,3-benzothiazol-2-yl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride (PubChem CID 121023583) has the molecular formula C27H28ClN3O4S2 and a molecular weight of 558.13 g/mol. Its IUPAC name is (E)-N-[3-(1,3-benzothiazol-2-yl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride.
| Compound Name | (E)-N-[3-(1,3-benzothiazol-2-yl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 121023583 |
| Molecular Formula | C27H28ClN3O4S2 |
| Molecular Weight | 558.13 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | (E)-N-[3-(1,3-benzothiazol-2-yl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride |
| SMILES | COc1cc(/C=C/C(=O)Nc2sc3c(c2-c2nc4ccccc4s2)CCN(C)C3)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C27H27N3O4S2.ClH/c1-30-12-11-17-22(15-30)36-27(24(17)26-28-18-7-5-6-8-21(18)35-26)29-23(31)10-9-16-13-19(32-2)25(34-4)20(14-16)33-3;/h5-10,13-14H,11-12,15H2,1-4H3,(H,29,31);1H/b10-9+; |
| InChIKey | VNYGXALOOROGMT-RRABGKBLSA-N |
| XLogP | 6.11 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.13 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|