C19H17N3OS2 — CID 46925869
N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]pent-4-ynamide (PubChem CID 46925869) has the molecular formula C19H17N3OS2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]pent-4-ynamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]pent-4-ynamide |
|---|---|
| PubChem CID | 46925869 |
| Molecular Formula | C19H17N3OS2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]pent-4-ynamide |
| SMILES | C#CCCC(=O)Nc1sc2c(c1-c1nc3ccccc3s1)CCNC2 |
| InChI | InChI=1S/C19H17N3OS2/c1-2-3-8-16(23)22-19-17(12-9-10-20-11-15(12)25-19)18-21-13-6-4-5-7-14(13)24-18/h1,4-7,20H,3,8-11H2,(H,22,23) |
| InChIKey | PVTIKTKFFFMPBF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|