C26H34N4O5S2 — CID 158107383
ethyl 3-[2-[2-[[3-[[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]-3-oxopropyl]amino]ethoxy]ethoxy]propanoate (PubChem CID 158107383) has the molecular formula C26H34N4O5S2 and a molecular weight of 546.72 g/mol. Its IUPAC name is ethyl 3-[2-[2-[[3-[[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]-3-oxopropyl]amino]ethoxy]ethoxy]propanoate.
| Compound Name | ethyl 3-[2-[2-[[3-[[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]-3-oxopropyl]amino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 158107383 |
| Molecular Formula | C26H34N4O5S2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | ethyl 3-[2-[2-[[3-[[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]-3-oxopropyl]amino]ethoxy]ethoxy]propanoate |
| SMILES | CCOC(=O)CCOCCOCCNCCC(=O)Nc1sc2c(c1-c1nc3ccccc3s1)CCNC2 |
| InChI | InChI=1S/C26H34N4O5S2/c1-2-35-23(32)9-13-33-15-16-34-14-12-27-11-8-22(31)30-26-24(18-7-10-28-17-21(18)37-26)25-29-19-5-3-4-6-20(19)36-25/h3-6,27-28H,2,7-17H2,1H3,(H,30,31) |
| InChIKey | MXHFPZMAPOXTLN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|