C27H31N5O4S3 — CID 155539570
3-(2-methoxyethylamino)-N-[3-[5-[3-(methylsulfamoyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155539570) has the molecular formula C27H31N5O4S3 and a molecular weight of 585.78 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[5-[3-(methylsulfamoyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[5-[3-(methylsulfamoyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155539570 |
| Molecular Formula | C27H31N5O4S3 |
| Molecular Weight | 585.78 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[5-[3-(methylsulfamoyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | CNS(=O)(=O)c1cccc(-c2ccc3sc(-c4c(NC(=O)CCNCCOC)sc5c4CCNC5)nc3c2)c1 |
| InChI | InChI=1S/C27H31N5O4S3/c1-28-39(34,35)19-5-3-4-17(14-19)18-6-7-22-21(15-18)31-26(37-22)25-20-8-10-30-16-23(20)38-27(25)32-24(33)9-11-29-12-13-36-2/h3-7,14-15,28-30H,8-13,16H2,1-2H3,(H,32,33) |
| InChIKey | FVKNEAFHMKUTTK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|