C27H28N6O2S2 — CID 155555249
3-(2-methoxyethylamino)-N-[3-[6-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155555249) has the molecular formula C27H28N6O2S2 and a molecular weight of 532.70 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[6-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[6-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155555249 |
| Molecular Formula | C27H28N6O2S2 |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[6-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3ccc(-c4ccnc5[nH]ccc45)cc3s1)CCNC2 |
| InChI | InChI=1S/C27H28N6O2S2/c1-35-13-12-28-9-7-23(34)33-27-24(19-4-8-29-15-22(19)37-27)26-32-20-3-2-16(14-21(20)36-26)17-5-10-30-25-18(17)6-11-31-25/h2-3,5-6,10-11,14,28-29H,4,7-9,12-13,15H2,1H3,(H,30,31)(H,33,34) |
| InChIKey | RJJPZKPJJXFMBJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|