C29H37N5O2S2 — CID 145202192
3-(2-methoxyethylamino)-N-[7-methyl-3-(5-pyridin-4-yl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide;propane (PubChem CID 145202192) has the molecular formula C29H37N5O2S2 and a molecular weight of 551.78 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[7-methyl-3-(5-pyridin-4-yl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide;propane.
| Compound Name | 3-(2-methoxyethylamino)-N-[7-methyl-3-(5-pyridin-4-yl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide;propane |
|---|---|
| PubChem CID | 145202192 |
| Molecular Formula | C29H37N5O2S2 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[7-methyl-3-(5-pyridin-4-yl-1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide;propane |
| SMILES | CCC.COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4ccncc4)ccc3s1)CCNC2C |
| InChI | InChI=1S/C26H29N5O2S2.C3H8/c1-16-24-19(7-12-29-16)23(26(35-24)31-22(32)8-11-28-13-14-33-2)25-30-20-15-18(3-4-21(20)34-25)17-5-9-27-10-6-17;1-3-2/h3-6,9-10,15-16,28-29H,7-8,11-14H2,1-2H3,(H,31,32);3H2,1-2H3 |
| InChIKey | MJLUQSOLNNYRSA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|