C24H26N4O3S — CID 1340200
N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 1340200) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 1340200 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-2-yl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | CC1(C)Cc2c(sc(NC(=O)CCCN3C(=O)c4ccccc4C3=O)c2C#N)C(C)(C)N1 |
| InChI | InChI=1S/C24H26N4O3S/c1-23(2)12-16-17(13-25)20(32-19(16)24(3,4)27-23)26-18(29)10-7-11-28-21(30)14-8-5-6-9-15(14)22(28)31/h5-6,8-9,27H,7,10-12H2,1-4H3,(H,26,29) |
| InChIKey | UKTHELWDJGMGOD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|