C31H46N4O4S2 — CID 23793326
4-[bis(2-methylpropyl)sulfamoyl]-N-[5,5,7,7-tetramethyl-3-(pyrrolidine-1-carbonyl)-4,6-dihydrothieno[2,3-c]pyridin-2-yl]benzamide (PubChem CID 23793326) has the molecular formula C31H46N4O4S2 and a molecular weight of 602.87 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)sulfamoyl]-N-[5,5,7,7-tetramethyl-3-(pyrrolidine-1-carbonyl)-4,6-dihydrothieno[2,3-c]pyridin-2-yl]benzamide.
| Compound Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-[5,5,7,7-tetramethyl-3-(pyrrolidine-1-carbonyl)-4,6-dihydrothieno[2,3-c]pyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 23793326 |
| Molecular Formula | C31H46N4O4S2 |
| Molecular Weight | 602.87 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-[5,5,7,7-tetramethyl-3-(pyrrolidine-1-carbonyl)-4,6-dihydrothieno[2,3-c]pyridin-2-yl]benzamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1ccc(C(=O)Nc2sc3c(c2C(=O)N2CCCC2)CC(C)(C)NC3(C)C)cc1 |
| InChI | InChI=1S/C31H46N4O4S2/c1-20(2)18-35(19-21(3)4)41(38,39)23-13-11-22(12-14-23)27(36)32-28-25(29(37)34-15-9-10-16-34)24-17-30(5,6)33-31(7,8)26(24)40-28/h11-14,20-21,33H,9-10,15-19H2,1-8H3,(H,32,36) |
| InChIKey | RKFHCBPFIYNNTA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.87 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |