C26H36N4O4S2 — CID 66981165
2-[[4-(cyclohexylmethylsulfamoyl)benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide (PubChem CID 66981165) has the molecular formula C26H36N4O4S2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 2-[[4-(cyclohexylmethylsulfamoyl)benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 2-[[4-(cyclohexylmethylsulfamoyl)benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66981165 |
| Molecular Formula | C26H36N4O4S2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 2-[[4-(cyclohexylmethylsulfamoyl)benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CC1(C)Cc2c(sc(NC(=O)c3ccc(S(=O)(=O)NCC4CCCCC4)cc3)c2C(N)=O)C(C)(C)N1 |
| InChI | InChI=1S/C26H36N4O4S2/c1-25(2)14-19-20(22(27)31)24(35-21(19)26(3,4)30-25)29-23(32)17-10-12-18(13-11-17)36(33,34)28-15-16-8-6-5-7-9-16/h10-13,16,28,30H,5-9,14-15H2,1-4H3,(H2,27,31)(H,29,32) |
| InChIKey | XFPAWXVMVIZPDA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |