C25H34N4O5S2 — CID 98150946
5,5,7,7-tetramethyl-2-[[4-[methyl-[[(2S)-oxolan-2-yl]methyl]sulfamoyl]benzoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide (PubChem CID 98150946) has the molecular formula C25H34N4O5S2 and a molecular weight of 534.70 g/mol. Its IUPAC name is 5,5,7,7-tetramethyl-2-[[4-[methyl-[[(2S)-oxolan-2-yl]methyl]sulfamoyl]benzoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 5,5,7,7-tetramethyl-2-[[4-[methyl-[[(2S)-oxolan-2-yl]methyl]sulfamoyl]benzoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 98150946 |
| Molecular Formula | C25H34N4O5S2 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 5,5,7,7-tetramethyl-2-[[4-[methyl-[[(2S)-oxolan-2-yl]methyl]sulfamoyl]benzoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CN(C[C@@H]1CCCO1)S(=O)(=O)c1ccc(C(=O)Nc2sc3c(c2C(N)=O)CC(C)(C)NC3(C)C)cc1 |
| InChI | InChI=1S/C25H34N4O5S2/c1-24(2)13-18-19(21(26)30)23(35-20(18)25(3,4)28-24)27-22(31)15-8-10-17(11-9-15)36(32,33)29(5)14-16-7-6-12-34-16/h8-11,16,28H,6-7,12-14H2,1-5H3,(H2,26,30)(H,27,31)/t16-/m0/s1 |
| InChIKey | QCIGODYCRXZSSC-INIZCTEOSA-N |
| XLogP | 3.06 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |