C12H15N5O3S — CID 110503199
ethyl 5-methyl-2-[[2-(1-methyltetrazol-5-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 110503199) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is ethyl 5-methyl-2-[[2-(1-methyltetrazol-5-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-[[2-(1-methyltetrazol-5-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503199 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | ethyl 5-methyl-2-[[2-(1-methyltetrazol-5-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)Cc1nnnn1C |
| InChI | InChI=1S/C12H15N5O3S/c1-4-20-12(19)8-5-7(2)21-11(8)13-10(18)6-9-14-15-16-17(9)3/h5H,4,6H2,1-3H3,(H,13,18) |
| InChIKey | YMKMNSQRBMHISD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |