C11H11N3O3S2 — CID 65216558
ethyl 5-methyl-2-(thiadiazole-4-carbonylamino)thiophene-3-carboxylate (PubChem CID 65216558) has the molecular formula C11H11N3O3S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is ethyl 5-methyl-2-(thiadiazole-4-carbonylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-(thiadiazole-4-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 65216558 |
| Molecular Formula | C11H11N3O3S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | ethyl 5-methyl-2-(thiadiazole-4-carbonylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)c1csnn1 |
| InChI | InChI=1S/C11H11N3O3S2/c1-3-17-11(16)7-4-6(2)19-10(7)12-9(15)8-5-18-14-13-8/h4-5H,3H2,1-2H3,(H,12,15) |
| InChIKey | JEKSIIXOHPIDAC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |