C13H12BrNO3S2 — CID 60793261
ethyl 2-[(5-bromothiophene-3-carbonyl)amino]-5-methylthiophene-3-carboxylate (PubChem CID 60793261) has the molecular formula C13H12BrNO3S2 and a molecular weight of 374.28 g/mol. Its IUPAC name is ethyl 2-[(5-bromothiophene-3-carbonyl)amino]-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-bromothiophene-3-carbonyl)amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 60793261 |
| Molecular Formula | C13H12BrNO3S2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | ethyl 2-[(5-bromothiophene-3-carbonyl)amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C13H12BrNO3S2/c1-3-18-13(17)9-4-7(2)20-12(9)15-11(16)8-5-10(14)19-6-8/h4-6H,3H2,1-2H3,(H,15,16) |
| InChIKey | GPAKHEPMKZXLNQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |