C19H21N5O3S — CID 110503186
methyl 4-(3,4-dimethylphenyl)-5-methyl-2-[[2-(1-methyltetrazol-5-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 110503186) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is methyl 4-(3,4-dimethylphenyl)-5-methyl-2-[[2-(1-methyltetrazol-5-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(3,4-dimethylphenyl)-5-methyl-2-[[2-(1-methyltetrazol-5-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503186 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | methyl 4-(3,4-dimethylphenyl)-5-methyl-2-[[2-(1-methyltetrazol-5-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)Cc2nnnn2C)sc(C)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H21N5O3S/c1-10-6-7-13(8-11(10)2)16-12(3)28-18(17(16)19(26)27-5)20-15(25)9-14-21-22-23-24(14)4/h6-8H,9H2,1-5H3,(H,20,25) |
| InChIKey | SQPDJWHSJXNNPE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|