C19H18NO5S- — CID 4748726
4-[[4-(3,4-dimethylphenyl)-3-methoxycarbonyl-5-methylthiophen-2-yl]amino]-4-oxobut-2-enoate (PubChem CID 4748726) has the molecular formula C19H18NO5S- and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-[[4-(3,4-dimethylphenyl)-3-methoxycarbonyl-5-methylthiophen-2-yl]amino]-4-oxobut-2-enoate.
| Compound Name | 4-[[4-(3,4-dimethylphenyl)-3-methoxycarbonyl-5-methylthiophen-2-yl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4748726 |
| Molecular Formula | C19H18NO5S- |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 4-[[4-(3,4-dimethylphenyl)-3-methoxycarbonyl-5-methylthiophen-2-yl]amino]-4-oxobut-2-enoate |
| SMILES | COC(=O)c1c(NC(=O)C=CC(=O)[O-])sc(C)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H19NO5S/c1-10-5-6-13(9-11(10)2)16-12(3)26-18(17(16)19(24)25-4)20-14(21)7-8-15(22)23/h5-9H,1-4H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | DARDLSOHWBBFCG-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|