C11H10NO5S- — CID 7454892
4-[(3-methoxycarbonyl-5-methylthiophen-2-yl)amino]-4-oxobut-2-enoate (PubChem CID 7454892) has the molecular formula C11H10NO5S- and a molecular weight of 268.27 g/mol. Its IUPAC name is 4-[(3-methoxycarbonyl-5-methylthiophen-2-yl)amino]-4-oxobut-2-enoate.
| Compound Name | 4-[(3-methoxycarbonyl-5-methylthiophen-2-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7454892 |
| Molecular Formula | C11H10NO5S- |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 4-[(3-methoxycarbonyl-5-methylthiophen-2-yl)amino]-4-oxobut-2-enoate |
| SMILES | COC(=O)c1cc(C)sc1NC(=O)C=CC(=O)[O-] |
| InChI | InChI=1S/C11H11NO5S/c1-6-5-7(11(16)17-2)10(18-6)12-8(13)3-4-9(14)15/h3-5H,1-2H3,(H,12,13)(H,14,15)/p-1 |
| InChIKey | MXCDQRVVPRFQTJ-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|