C18H16NO5S- — CID 4082486
4-[(5-benzyl-3-methoxycarbonyl-4-methylthiophen-2-yl)amino]-4-oxobut-2-enoate (PubChem CID 4082486) has the molecular formula C18H16NO5S- and a molecular weight of 358.40 g/mol. Its IUPAC name is 4-[(5-benzyl-3-methoxycarbonyl-4-methylthiophen-2-yl)amino]-4-oxobut-2-enoate.
| Compound Name | 4-[(5-benzyl-3-methoxycarbonyl-4-methylthiophen-2-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4082486 |
| Molecular Formula | C18H16NO5S- |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-[(5-benzyl-3-methoxycarbonyl-4-methylthiophen-2-yl)amino]-4-oxobut-2-enoate |
| SMILES | COC(=O)c1c(NC(=O)C=CC(=O)[O-])sc(Cc2ccccc2)c1C |
| InChI | InChI=1S/C18H17NO5S/c1-11-13(10-12-6-4-3-5-7-12)25-17(16(11)18(23)24-2)19-14(20)8-9-15(21)22/h3-9H,10H2,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | HTYFKYNJJYRMJB-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|