C23H23NO3S — CID 23938336
methyl 5-benzyl-2-[(2-ethoxyphenyl)methylideneamino]-4-methylthiophene-3-carboxylate (PubChem CID 23938336) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is methyl 5-benzyl-2-[(2-ethoxyphenyl)methylideneamino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-[(2-ethoxyphenyl)methylideneamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 23938336 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | methyl 5-benzyl-2-[(2-ethoxyphenyl)methylideneamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOc1ccccc1C=Nc1sc(Cc2ccccc2)c(C)c1C(=O)OC |
| InChI | InChI=1S/C23H23NO3S/c1-4-27-19-13-9-8-12-18(19)15-24-22-21(23(25)26-3)16(2)20(28-22)14-17-10-6-5-7-11-17/h5-13,15H,4,14H2,1-3H3 |
| InChIKey | QGWJOZIAPNRXMD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|