C18H17NO7S — CID 7762726
dimethyl 5-[[2-(2-formylphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 7762726) has the molecular formula C18H17NO7S and a molecular weight of 391.40 g/mol. Its IUPAC name is dimethyl 5-[[2-(2-formylphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(2-formylphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7762726 |
| Molecular Formula | C18H17NO7S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | dimethyl 5-[[2-(2-formylphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)COc2ccccc2C=O)c(C(=O)OC)c1C |
| InChI | InChI=1S/C18H17NO7S/c1-10-14(17(22)24-2)16(27-15(10)18(23)25-3)19-13(21)9-26-12-7-5-4-6-11(12)8-20/h4-8H,9H2,1-3H3,(H,19,21) |
| InChIKey | FXAILEIIHCZTID-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|