C20H24N2O5S — CID 3353111
methyl 5-(diethylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate (PubChem CID 3353111) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl 5-(diethylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-(diethylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3353111 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | methyl 5-(diethylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=O)COc2ccccc2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C20H24N2O5S/c1-5-22(6-2)19(24)17-13(3)16(20(25)26-4)18(28-17)21-15(23)12-27-14-10-8-7-9-11-14/h7-11H,5-6,12H2,1-4H3,(H,21,23) |
| InChIKey | XLAQSQYTLCFNRF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |