C21H26N2O5S — CID 2976622
ethyl 5-(butylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate (PubChem CID 2976622) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 5-(butylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-(butylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2976622 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl 5-(butylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCCCNC(=O)c1sc(NC(=O)COc2ccccc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C21H26N2O5S/c1-4-6-12-22-19(25)18-14(3)17(21(26)27-5-2)20(29-18)23-16(24)13-28-15-10-8-7-9-11-15/h7-11H,4-6,12-13H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | KXQJBIFCJIDNEU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|