C24H24N2O5S — CID 17061863
ethyl 5-(benzylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate (PubChem CID 17061863) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is ethyl 5-(benzylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-(benzylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17061863 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | ethyl 5-(benzylcarbamoyl)-4-methyl-2-[(2-phenoxyacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COc2ccccc2)sc(C(=O)NCc2ccccc2)c1C |
| InChI | InChI=1S/C24H24N2O5S/c1-3-30-24(29)20-16(2)21(22(28)25-14-17-10-6-4-7-11-17)32-23(20)26-19(27)15-31-18-12-8-5-9-13-18/h4-13H,3,14-15H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | QVKXFBKCVLPDJX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |