C23H21ClN2O4S — CID 17064615
ethyl 5-(benzylcarbamoyl)-2-[(2-chlorobenzoyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 17064615) has the molecular formula C23H21ClN2O4S and a molecular weight of 456.95 g/mol. Its IUPAC name is ethyl 5-(benzylcarbamoyl)-2-[(2-chlorobenzoyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(benzylcarbamoyl)-2-[(2-chlorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17064615 |
| Molecular Formula | C23H21ClN2O4S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | ethyl 5-(benzylcarbamoyl)-2-[(2-chlorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccccc2Cl)sc(C(=O)NCc2ccccc2)c1C |
| InChI | InChI=1S/C23H21ClN2O4S/c1-3-30-23(29)18-14(2)19(21(28)25-13-15-9-5-4-6-10-15)31-22(18)26-20(27)16-11-7-8-12-17(16)24/h4-12H,3,13H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | WDUVPHIEKOLACT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |