C10H16O2S — CID 143851717
ethane;methyl 2,5-dimethylthiophene-3-carboxylate (PubChem CID 143851717) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is ethane;methyl 2,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethane;methyl 2,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 143851717 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | ethane;methyl 2,5-dimethylthiophene-3-carboxylate |
| SMILES | CC.COC(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C8H10O2S.C2H6/c1-5-4-7(6(2)11-5)8(9)10-3;1-2/h4H,1-3H3;1-2H3 |
| InChIKey | YARHFFBQZRPULE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |