C19H22O4S2 — CID 10785925
dimethyl 2-[bis(2,5-dimethylthiophen-3-yl)methylidene]butanedioate (PubChem CID 10785925) has the molecular formula C19H22O4S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is dimethyl 2-[bis(2,5-dimethylthiophen-3-yl)methylidene]butanedioate.
| Compound Name | dimethyl 2-[bis(2,5-dimethylthiophen-3-yl)methylidene]butanedioate |
|---|---|
| PubChem CID | 10785925 |
| Molecular Formula | C19H22O4S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | dimethyl 2-[bis(2,5-dimethylthiophen-3-yl)methylidene]butanedioate |
| SMILES | COC(=O)CC(C(=O)OC)=C(c1cc(C)sc1C)c1cc(C)sc1C |
| InChI | InChI=1S/C19H22O4S2/c1-10-7-14(12(3)24-10)18(15-8-11(2)25-13(15)4)16(19(21)23-6)9-17(20)22-5/h7-8H,9H2,1-6H3 |
| InChIKey | DAEYYUIPGGJRLW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|