C17H22OS — CID 81095528
2-adamantyl-(2,5-dimethylthiophen-3-yl)methanone (PubChem CID 81095528) has the molecular formula C17H22OS and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-adamantyl-(2,5-dimethylthiophen-3-yl)methanone.
| Compound Name | 2-adamantyl-(2,5-dimethylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 81095528 |
| Molecular Formula | C17H22OS |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-adamantyl-(2,5-dimethylthiophen-3-yl)methanone |
| SMILES | Cc1cc(C(=O)C2C3CC4CC(C3)CC2C4)c(C)s1 |
| InChI | InChI=1S/C17H22OS/c1-9-3-15(10(2)19-9)17(18)16-13-5-11-4-12(7-13)8-14(16)6-11/h3,11-14,16H,4-8H2,1-2H3 |
| InChIKey | SYCJKQVVKJAWMI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |