C19H26BrNO — CID 154574133
1-(2-adamantyl)-2-(3,5-dimethylpyridin-1-ium-1-yl)ethanone bromide (PubChem CID 154574133) has the molecular formula C19H26BrNO and a molecular weight of 364.33 g/mol. Its IUPAC name is 1-(2-adamantyl)-2-(3,5-dimethylpyridin-1-ium-1-yl)ethanone bromide.
| Compound Name | 1-(2-adamantyl)-2-(3,5-dimethylpyridin-1-ium-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 154574133 |
| Molecular Formula | C19H26BrNO |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(2-adamantyl)-2-(3,5-dimethylpyridin-1-ium-1-yl)ethanone bromide |
| SMILES | Cc1cc(C)c[n+](CC(=O)C2C3CC4CC(C3)CC2C4)c1.[Br-] |
| InChI | InChI=1S/C19H26NO.BrH/c1-12-3-13(2)10-20(9-12)11-18(21)19-16-5-14-4-15(7-16)8-17(19)6-14;/h3,9-10,14-17,19H,4-8,11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PSYNXCNAFFXXAT-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|