About 2-adamantyl-(2,3-dichlorophenyl)methanone
2-adamantyl-(2,3-dichlorophenyl)methanone (PubChem CID 114970494) has the molecular formula C17H18Cl2O
and a molecular weight of 309.24 g/mol. Its IUPAC name is 2-adamantyl-(2,3-dichlorophenyl)methanone.
Molecular Properties
| Compound Name | 2-adamantyl-(2,3-dichlorophenyl)methanone |
| PubChem CID | 114970494 |
| Molecular Formula | C17H18Cl2O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-adamantyl-(2,3-dichlorophenyl)methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H18Cl2O/c18-14-3-1-2-13(16(14)19)17(20)15-11-5-9-4-10(7-11)8-12(15)6-9/h1-3,9-12,15H,4-8H2 |
| InChIKey | IUWCFCGQHNRUTP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-adamantyl-(2,3-dichlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantyl-(2,3-dichlorophenyl)methanone?
The IUPAC name of 2-adamantyl-(2,3-dichlorophenyl)methanone (CID 114970494) is 2-adamantyl-(2,3-dichlorophenyl)methanone.
What is the SMILES notation for 2-adamantyl-(2,3-dichlorophenyl)methanone?
The canonical SMILES for 2-adamantyl-(2,3-dichlorophenyl)methanone is O=C(c1cccc(Cl)c1Cl)C1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-adamantyl-(2,3-dichlorophenyl)methanone?
The InChIKey is IUWCFCGQHNRUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2O/c18-14-3-1-2-13(16(14)19)17(20)15-11-5-9-4-10(7-11)8-12(15)6-9/h1-3,9-12,15H,4-8H2.
What are the key properties of 2-adamantyl-(2,3-dichlorophenyl)methanone?
2-adamantyl-(2,3-dichlorophenyl)methanone has a molecular weight of 309.24 g/mol, XLogP of 5.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantyl-(2,3-dichlorophenyl)methanone is sourced from PubChem (CID 114970494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).