C14H17Cl2NO — CID 116584564
[2-(aminomethyl)cyclohexyl]-(2,3-dichlorophenyl)methanone (PubChem CID 116584564) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is [2-(aminomethyl)cyclohexyl]-(2,3-dichlorophenyl)methanone.
| Compound Name | [2-(aminomethyl)cyclohexyl]-(2,3-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 116584564 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [2-(aminomethyl)cyclohexyl]-(2,3-dichlorophenyl)methanone |
| SMILES | NCC1CCCCC1C(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl2NO/c15-12-7-3-6-11(13(12)16)14(18)10-5-2-1-4-9(10)8-17/h3,6-7,9-10H,1-2,4-5,8,17H2 |
| InChIKey | UTBIEKUOFDGYHF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |