2,3-dichlorobenzenecarboselenoyl chloride

C7H3Cl3Se — CID 150296401

IUPAC2,3-dichlorobenzenecarboselenoyl chloride
SMILESClC(=[Se])c1cccc(Cl)c1Cl
InChIInChI=1S/C7H3Cl3Se/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H
InChIKeyGIRDKHNIOHBTKY-UHFFFAOYSA-N
MW272.42 g/mol
LogP2.88
Rot. Bonds1

About 2,3-dichlorobenzenecarboselenoyl chloride

2,3-dichlorobenzenecarboselenoyl chloride (PubChem CID 150296401) has the molecular formula C7H3Cl3Se and a molecular weight of 272.42 g/mol. Its IUPAC name is 2,3-dichlorobenzenecarboselenoyl chloride.

Molecular Properties

Compound Name2,3-dichlorobenzenecarboselenoyl chloride
PubChem CID150296401
Molecular FormulaC7H3Cl3Se
Molecular Weight272.42 g/mol
Exact Mass271.85
IUPAC Name2,3-dichlorobenzenecarboselenoyl chloride
SMILESClC(=[Se])c1cccc(Cl)c1Cl
InChIInChI=1S/C7H3Cl3Se/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H
InChIKeyGIRDKHNIOHBTKY-UHFFFAOYSA-N
XLogP2.88
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.42
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2,3-dichlorobenzenecarboselenoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dichlorobenzenecarboselenoyl chloride?
The IUPAC name of 2,3-dichlorobenzenecarboselenoyl chloride (CID 150296401) is 2,3-dichlorobenzenecarboselenoyl chloride.
What is the SMILES notation for 2,3-dichlorobenzenecarboselenoyl chloride?
The canonical SMILES for 2,3-dichlorobenzenecarboselenoyl chloride is ClC(=[Se])c1cccc(Cl)c1Cl.
What is the InChIKey of 2,3-dichlorobenzenecarboselenoyl chloride?
The InChIKey is GIRDKHNIOHBTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl3Se/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H.
What are the key properties of 2,3-dichlorobenzenecarboselenoyl chloride?
2,3-dichlorobenzenecarboselenoyl chloride has a molecular weight of 272.42 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichlorobenzenecarboselenoyl chloride is sourced from PubChem (CID 150296401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).