C10H14N2O2S — CID 9075082
methyl N-[(Z)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]carbamate (PubChem CID 9075082) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is methyl N-[(Z)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]carbamate |
|---|---|
| PubChem CID | 9075082 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl N-[(Z)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]carbamate |
| SMILES | COC(=O)N/N=C(/C)c1cc(C)sc1C |
| InChI | InChI=1S/C10H14N2O2S/c1-6-5-9(8(3)15-6)7(2)11-12-10(13)14-4/h5H,1-4H3,(H,12,13)/b11-7- |
| InChIKey | YGILXVABSVHFBK-XFFZJAGNSA-N |
| XLogP | 2.44 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|