2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate

C10H14O2S2 — CID 78832371

IUPAC2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate
SMILESCSCCOC(=O)c1cc(C)sc1C
InChIInChI=1S/C10H14O2S2/c1-7-6-9(8(2)14-7)10(11)12-4-5-13-3/h6H,4-5H2,1-3H3
InChIKeyKUKRDWGYUDHDSQ-UHFFFAOYSA-N
MW230.35 g/mol
LogP2.88
Rot. Bonds4

About 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate

2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate (PubChem CID 78832371) has the molecular formula C10H14O2S2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate.

Molecular Properties

Compound Name2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate
PubChem CID78832371
Molecular FormulaC10H14O2S2
Molecular Weight230.35 g/mol
Exact Mass230.04
IUPAC Name2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate
SMILESCSCCOC(=O)c1cc(C)sc1C
InChIInChI=1S/C10H14O2S2/c1-7-6-9(8(2)14-7)10(11)12-4-5-13-3/h6H,4-5H2,1-3H3
InChIKeyKUKRDWGYUDHDSQ-UHFFFAOYSA-N
XLogP2.88
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.35
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate?
The IUPAC name of 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate (CID 78832371) is 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate.
What is the SMILES notation for 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate?
The canonical SMILES for 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate is CSCCOC(=O)c1cc(C)sc1C.
What is the InChIKey of 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate?
The InChIKey is KUKRDWGYUDHDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S2/c1-7-6-9(8(2)14-7)10(11)12-4-5-13-3/h6H,4-5H2,1-3H3.
What are the key properties of 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate?
2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate has a molecular weight of 230.35 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate is sourced from PubChem (CID 78832371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).