C10H14O2S2 — CID 78832371
2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate (PubChem CID 78832371) has the molecular formula C10H14O2S2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate.
| Compound Name | 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 78832371 |
| Molecular Formula | C10H14O2S2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-methylsulfanylethyl 2,5-dimethylthiophene-3-carboxylate |
| SMILES | CSCCOC(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C10H14O2S2/c1-7-6-9(8(2)14-7)10(11)12-4-5-13-3/h6H,4-5H2,1-3H3 |
| InChIKey | KUKRDWGYUDHDSQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|