C12H13NO3S — CID 77001926
2-(hexa-2,4-dienoylamino)-5-methylthiophene-3-carboxylic acid (PubChem CID 77001926) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-(hexa-2,4-dienoylamino)-5-methylthiophene-3-carboxylic acid.
| Compound Name | 2-(hexa-2,4-dienoylamino)-5-methylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 77001926 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-(hexa-2,4-dienoylamino)-5-methylthiophene-3-carboxylic acid |
| SMILES | CC=CC=CC(=O)Nc1sc(C)cc1C(=O)O |
| InChI | InChI=1S/C12H13NO3S/c1-3-4-5-6-10(14)13-11-9(12(15)16)7-8(2)17-11/h3-7H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | FWMYUNXUZUWNOB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|