C25H28NO5S- — CID 4605238
3-[[4-(3,4-dimethylphenyl)-3-ethoxycarbonyl-5-methylthiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 4605238) has the molecular formula C25H28NO5S- and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-[[4-(3,4-dimethylphenyl)-3-ethoxycarbonyl-5-methylthiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 3-[[4-(3,4-dimethylphenyl)-3-ethoxycarbonyl-5-methylthiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 4605238 |
| Molecular Formula | C25H28NO5S- |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 3-[[4-(3,4-dimethylphenyl)-3-ethoxycarbonyl-5-methylthiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C2C3CCC(C3)C2C(=O)[O-])sc(C)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C25H29NO5S/c1-5-31-25(30)21-18(15-7-6-12(2)13(3)10-15)14(4)32-23(21)26-22(27)19-16-8-9-17(11-16)20(19)24(28)29/h6-7,10,16-17,19-20H,5,8-9,11H2,1-4H3,(H,26,27)(H,28,29)/p-1 |
| InChIKey | KLURAKFRZWRWTE-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|