C23H29NO5S — CID 2946707
ethyl 2-(cyclohexanecarbonylamino)-4-(3,4-dimethoxyphenyl)-5-methylthiophene-3-carboxylate (PubChem CID 2946707) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is ethyl 2-(cyclohexanecarbonylamino)-4-(3,4-dimethoxyphenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(cyclohexanecarbonylamino)-4-(3,4-dimethoxyphenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2946707 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | ethyl 2-(cyclohexanecarbonylamino)-4-(3,4-dimethoxyphenyl)-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C2CCCCC2)sc(C)c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H29NO5S/c1-5-29-23(26)20-19(16-11-12-17(27-3)18(13-16)28-4)14(2)30-22(20)24-21(25)15-9-7-6-8-10-15/h11-13,15H,5-10H2,1-4H3,(H,24,25) |
| InChIKey | QYGQRNVDOHKGNT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|