C16H19NO3S — CID 82028154
ethyl 2-amino-4-(4-methoxy-3-methylphenyl)-5-methylthiophene-3-carboxylate (PubChem CID 82028154) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is ethyl 2-amino-4-(4-methoxy-3-methylphenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-4-(4-methoxy-3-methylphenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 82028154 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | ethyl 2-amino-4-(4-methoxy-3-methylphenyl)-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(C)c1-c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C16H19NO3S/c1-5-20-16(18)14-13(10(3)21-15(14)17)11-6-7-12(19-4)9(2)8-11/h6-8H,5,17H2,1-4H3 |
| InChIKey | CZVZDVKXXPOXEY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|