C18H20N2O4S — CID 39079152
ethyl 2-amino-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-5-methylthiophene-3-carboxylate (PubChem CID 39079152) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is ethyl 2-amino-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 39079152 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | ethyl 2-amino-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(C)c1-c1ccc2c(c1)N(CC)C(=O)CO2 |
| InChI | InChI=1S/C18H20N2O4S/c1-4-20-12-8-11(6-7-13(12)24-9-14(20)21)15-10(3)25-17(19)16(15)18(22)23-5-2/h6-8H,4-5,9,19H2,1-3H3 |
| InChIKey | OEIMCMIDZRTRIO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|